1-hydroxy-2-unsubstituted benzenoids
Aobchem 2 4-Dichloro-6-hydroxybenzoic acid | ≥97% | CAS 99725-34-5 | C7H4Cl2O3 | 1g
2 4-Dichloro-6-hydroxybenzoic acid | ≥97% | CAS 99725-34-5 | C7H4Cl2O3 | 1g
Medchemexpress LLC 4-hydroxybenzoic acid-13C6 | 287399-29-5 | 99.9% | 144.08 | C13C6H6O3 | 1.2mg
4-Hydroxybenzoic acid-13C6 is the 13C labeled isotope of 4-Hydroxybenzoic acid-13C6 4-Hydroxybenzoic acid is a phenolic derivative of benzoic acid which can inhibit most Gram-positive bacteria and some Gram-negative bacteria with an IC50 value of 160 g/mL
eMolecules 102872-33-3 | 3-Amino-3-(3-hydroxyphenyl)propanoic acid | Apollo Scientific | MFCD01871309 | 181.191 | C9H11NO3 | 95.000 | NC(CC(O)=O)c1cccc(O)c1 | 1g | 562459556
3-Amino-3-(3-hydroxyphenyl)propanoic acid | Apollo Scientific | 102872-33-3 | MFCD01871309 | 181.191 | C9H11NO3 | 95.000 | NC(CC(O)=O)c1cccc(O)c1 | 1g | 562459556
Cambridge Isotope Laboratories 4-HYDROXYBENZOIC ACID (CARBOXYL-13C, 99%), 0.5 G
4-HYDROXYBENZOIC ACID (CARBOXYL-13C, 99%), 0.5 G
eMolecules 621-37-4 | 3-Hydroxyphenylacetic acid | Key Organics/BIONET | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 10mg | 564159606
3-Hydroxyphenylacetic acid | Key Organics/BIONET | 621-37-4 | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 10mg | 564159606
eMolecules 56961-31-0 | 2-Chloro-6-hydroxybenzoic acid | MFCD10687031 | 1g
Ambeed | 2-Chloro-6-hydroxybenzoic acid | 1g | 552707971 | A327508 | 56961-31-0 | MFCD10687031 | 172.560 | C7H5ClO3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 74454-78-7 | 3-(4-Hydroxyphenyl)-N-benzyl-propionamide | Oakwood Chemical | MFCD03093990 | 255.317 | C16H17NO2 | 96.000 | Oc1ccc(CCC(=O)NCc2ccccc2)cc1 | 250mg | 537709919
3-(4-Hydroxyphenyl)-N-benzyl-propionamide | Oakwood Chemical | 74454-78-7 | MFCD03093990 | 255.317 | C16H17NO2 | 96.000 | Oc1ccc(CCC(=O)NCc2ccccc2)cc1 | 250mg | 537709919
Apexbio Technology LLC 3-Hydroxyphenylacetic acid 621-37-4 5g
3-Hydroxyphenylacetic acid (CAS 621-37-4) is an endogenous aromatic organic acid and a secondary intermediate in the metabolic pathways of tyrosine and phenylalanine Evidence suggests that it participates in modulating interactions between the gut microbiota and host metabolic processes and may impact neurotransmitter homeostasis Due to its involvement in these biochemical pathways 3-hydroxyphenylacetic acid is frequently employed as a metabolic biomarker to assess gut microbial activity and to investigate the pathophysiological mechanisms underlying neuro-metabolic disorders
eMolecules 1421263-29-7 | 4-(2-Hydroxyphenyl)-5-methyl-2-(3-pyridyl)thiazole | Oakwood Chemical | MFCD22682982 | 268.330 | C15H12N2OS | 97.000 | Cc1sc(nc1-c1ccccc1O)-c1cccnc1 | 5g | 537706022
4-(2-Hydroxyphenyl)-5-methyl-2-(3-pyridyl)thiazole | Oakwood Chemical | 1421263-29-7 | MFCD22682982 | 268.330 | C15H12N2OS | 97.000 | Cc1sc(nc1-c1ccccc1O)-c1cccnc1 | 5g | 537706022
eMolecules 1421261-35-9 | 4-(2-Hydroxyphenyl)-5-methyl-2-(4-pyridyl)thiazole | Oakwood Chemical | MFCD22683035 | 268.330 | C15H12N2OS | 95.000 | Cc1sc(nc1-c1ccccc1O)-c1ccncc1 | 1g | 537706025
4-(2-Hydroxyphenyl)-5-methyl-2-(4-pyridyl)thiazole | Oakwood Chemical | 1421261-35-9 | MFCD22683035 | 268.330 | C15H12N2OS | 95.000 | Cc1sc(nc1-c1ccccc1O)-c1ccncc1 | 1g | 537706025
eMolecules 934-34-9 | 2-Hydroxybenzothiazole | Oakwood Chemical | MFCD00022868 | 151.180 | C7H5NOS | 97.000 | Oc1nc2ccccc2s1 | 1g | 537671027
2-Hydroxybenzothiazole | Oakwood Chemical | 934-34-9 | MFCD00022868 | 151.180 | C7H5NOS | 97.000 | Oc1nc2ccccc2s1 | 1g | 537671027
eMolecules 621-37-4 | 3-Hydroxyphenylacetic acid | Key Organics/BIONET | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 1mg | 564159604
3-Hydroxyphenylacetic acid | Key Organics/BIONET | 621-37-4 | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 1mg | 564159604
Medchemexpress LLC DPN (Diarylpropionitrile) | 1428-67-7 | MFCD01695412 | 239.27 g/mol | C15H13NO2 | 50MG
DPN (Diarylpropionitrile) is a non-steroidal, selective estrogen receptor β (ERβ) ligand used in research to probe ERβ signaling and neuroprotective mechanisms. It is commonly used in in vitro and in vivo pharmacology studies investigating estrogen receptor function and neurobiology.